C20H27FN2O3 — CID 90995386
3-[(4-fluorophenyl)methyl]-2,5-dihydroxy-1-(3-methyloct-1-yn-3-yl)-1,3-diazinan-4-one (PubChem CID 90995386) has the molecular formula C20H27FN2O3 and a molecular weight of 362.45 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-2,5-dihydroxy-1-(3-methyloct-1-yn-3-yl)-1,3-diazinan-4-one.
| Compound Name | 3-[(4-fluorophenyl)methyl]-2,5-dihydroxy-1-(3-methyloct-1-yn-3-yl)-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 90995386 |
| Molecular Formula | C20H27FN2O3 |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-2,5-dihydroxy-1-(3-methyloct-1-yn-3-yl)-1,3-diazinan-4-one |
| SMILES | C#CC(C)(CCCCC)N1CC(O)C(=O)N(Cc2ccc(F)cc2)C1O |
| InChI | InChI=1S/C20H27FN2O3/c1-4-6-7-12-20(3,5-2)23-14-17(24)18(25)22(19(23)26)13-15-8-10-16(21)11-9-15/h2,8-11,17,19,24,26H,4,6-7,12-14H2,1,3H3 |
| InChIKey | DRLQZYBMYXYIKO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|