C40H45F7O7 — CID 90995434
[4-[(2S)-octan-2-yl]oxycarbonylphenyl] 4-[4-[6-[4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentanoyl]oxyhexoxy]phenyl]benzoate (PubChem CID 90995434) has the molecular formula C40H45F7O7 and a molecular weight of 770.78 g/mol. Its IUPAC name is [4-[(2S)-octan-2-yl]oxycarbonylphenyl] 4-[4-[6-[4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentanoyl]oxyhexoxy]phenyl]benzoate.
| Compound Name | [4-[(2S)-octan-2-yl]oxycarbonylphenyl] 4-[4-[6-[4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentanoyl]oxyhexoxy]phenyl]benzoate |
|---|---|
| PubChem CID | 90995434 |
| Molecular Formula | C40H45F7O7 |
| Molecular Weight | 770.78 g/mol |
| Exact Mass | 770.31 |
| IUPAC Name | [4-[(2S)-octan-2-yl]oxycarbonylphenyl] 4-[4-[6-[4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentanoyl]oxyhexoxy]phenyl]benzoate |
| SMILES | CCCCCC[C@H](C)OC(=O)c1ccc(OC(=O)c2ccc(-c3ccc(OCCCCCCOC(=O)CCC(F)(C(F)(F)F)C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C40H45F7O7/c1-3-4-5-8-11-28(2)53-36(49)32-18-22-34(23-19-32)54-37(50)31-14-12-29(13-15-31)30-16-20-33(21-17-30)51-26-9-6-7-10-27-52-35(48)24-25-38(41,39(42,43)44)40(45,46)47/h12-23,28H,3-11,24-27H2,1-2H3/t28-/m0/s1 |
| InChIKey | FIHWWNCMRMMGKN-NDEPHWFRSA-N |
| XLogP | 11.18 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.78 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|