C19H29N — CID 90995811
(3Z)-3-(3,4-dimethylocta-4,7-dien-2-ylidene)-7-ethyl-5,6-dihydro-4H-azocine (PubChem CID 90995811) has the molecular formula C19H29N and a molecular weight of 271.45 g/mol. Its IUPAC name is (3Z)-3-(3,4-dimethylocta-4,7-dien-2-ylidene)-7-ethyl-5,6-dihydro-4H-azocine.
| Compound Name | (3Z)-3-(3,4-dimethylocta-4,7-dien-2-ylidene)-7-ethyl-5,6-dihydro-4H-azocine |
|---|---|
| PubChem CID | 90995811 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | (3Z)-3-(3,4-dimethylocta-4,7-dien-2-ylidene)-7-ethyl-5,6-dihydro-4H-azocine |
| SMILES | C=CCC=C(C)C(C)/C(C)=C1\C=N/C=C(CC)CCC1 |
| InChI | InChI=1S/C19H29N/c1-6-8-10-15(3)16(4)17(5)19-12-9-11-18(7-2)13-20-14-19/h6,10,13-14,16H,1,7-9,11-12H2,2-5H3/b15-10?,18-13?,19-17-,20-14- |
| InChIKey | ZSMDFBVYSDTXIZ-COZWHKERSA-N |
| XLogP | 6.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|