C19H16FNO2S — CID 90995967
[4-(1-fluoroethoxy)phenyl]-[3-(2-thiophen-2-ylethenyl)pyrrol-1-yl]methanone (PubChem CID 90995967) has the molecular formula C19H16FNO2S and a molecular weight of 341.41 g/mol. Its IUPAC name is [4-(1-fluoroethoxy)phenyl]-[3-(2-thiophen-2-ylethenyl)pyrrol-1-yl]methanone.
| Compound Name | [4-(1-fluoroethoxy)phenyl]-[3-(2-thiophen-2-ylethenyl)pyrrol-1-yl]methanone |
|---|---|
| PubChem CID | 90995967 |
| Molecular Formula | C19H16FNO2S |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | [4-(1-fluoroethoxy)phenyl]-[3-(2-thiophen-2-ylethenyl)pyrrol-1-yl]methanone |
| SMILES | CC(F)Oc1ccc(C(=O)n2ccc(C=Cc3cccs3)c2)cc1 |
| InChI | InChI=1S/C19H16FNO2S/c1-14(20)23-17-7-5-16(6-8-17)19(22)21-11-10-15(13-21)4-9-18-3-2-12-24-18/h2-14H,1H3 |
| InChIKey | HOVKGIAPRXFJFK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |