About CID 90996002
CID 90996002 (PubChem CID 90996002) has the molecular formula C42H30BN4O2
and a molecular weight of 633.54 g/mol.
Molecular Properties
| Compound Name | CID 90996002 |
| PubChem CID | 90996002 |
| Molecular Formula | C42H30BN4O2 |
| Molecular Weight | 633.54 g/mol |
| Exact Mass | 633.25 |
| IUPAC Name | — |
| SMILES | [B](Oc1ccc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc1)Oc1ccc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc1 |
| InChI | InChI=1S/C42H30BN4O2/c1-5-13-29(14-6-1)37-38(30-15-7-2-8-16-30)45-41(44-37)33-21-25-35(26-22-33)48-43-49-36-27-23-34(24-28-36)42-46-39(31-17-9-3-10-18-31)40(47-42)32-19-11-4-12-20-32/h1-28H,(H,44,45)(H,46,47) |
| InChIKey | ZVLSPJCUMGSLKE-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 633.54 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 90996002 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90996002?
The IUPAC name of CID 90996002 (CID 90996002) is not available.
What is the SMILES notation for CID 90996002?
The canonical SMILES for CID 90996002 is [B](Oc1ccc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc1)Oc1ccc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc1.
What is the InChIKey of CID 90996002?
The InChIKey is ZVLSPJCUMGSLKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C42H30BN4O2/c1-5-13-29(14-6-1)37-38(30-15-7-2-8-16-30)45-41(44-37)33-21-25-35(26-22-33)48-43-49-36-27-23-34(24-28-36)42-46-39(31-17-9-3-10-18-31)40(47-42)32-19-11-4-12-20-32/h1-28H,(H,44,45)(H,46,47).
What are the key properties of CID 90996002?
CID 90996002 has a molecular weight of 633.54 g/mol, XLogP of 10.13, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90996002 is sourced from PubChem (CID 90996002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).