C6H11IN4 — CID 90996025
2-iodo-1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane (PubChem CID 90996025) has the molecular formula C6H11IN4 and a molecular weight of 266.09 g/mol. Its IUPAC name is 2-iodo-1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane.
| Compound Name | 2-iodo-1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 90996025 |
| Molecular Formula | C6H11IN4 |
| Molecular Weight | 266.09 g/mol |
| Exact Mass | 266.00 |
| IUPAC Name | 2-iodo-1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane |
| SMILES | IC1N2CN3CN(C2)CN1C3 |
| InChI | InChI=1S/C6H11IN4/c7-6-10-2-8-1-9(4-10)5-11(6)3-8/h6H,1-5H2 |
| InChIKey | JYPGWSBBPWLTJZ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.09 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|