About 1-[3-(2,4-dimethylphenyl)phenyl]-2,4-dimethylbenzene
1-[3-(2,4-dimethylphenyl)phenyl]-2,4-dimethylbenzene (PubChem CID 90996196) has the molecular formula C22H22
and a molecular weight of 286.42 g/mol. Its IUPAC name is 1-[3-(2,4-dimethylphenyl)phenyl]-2,4-dimethylbenzene.
Molecular Properties
| Compound Name | 1-[3-(2,4-dimethylphenyl)phenyl]-2,4-dimethylbenzene |
| PubChem CID | 90996196 |
| Molecular Formula | C22H22 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1-[3-(2,4-dimethylphenyl)phenyl]-2,4-dimethylbenzene |
| SMILES | Cc1ccc(-c2cccc(-c3ccc(C)cc3C)c2)c(C)c1 |
| InChI | InChI=1S/C22H22/c1-15-8-10-21(17(3)12-15)19-6-5-7-20(14-19)22-11-9-16(2)13-18(22)4/h5-14H,1-4H3 |
| InChIKey | JGOWIHSBJATBDP-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-[3-(2,4-dimethylphenyl)phenyl]-2,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2,4-dimethylphenyl)phenyl]-2,4-dimethylbenzene?
The IUPAC name of 1-[3-(2,4-dimethylphenyl)phenyl]-2,4-dimethylbenzene (CID 90996196) is 1-[3-(2,4-dimethylphenyl)phenyl]-2,4-dimethylbenzene.
What is the SMILES notation for 1-[3-(2,4-dimethylphenyl)phenyl]-2,4-dimethylbenzene?
The canonical SMILES for 1-[3-(2,4-dimethylphenyl)phenyl]-2,4-dimethylbenzene is Cc1ccc(-c2cccc(-c3ccc(C)cc3C)c2)c(C)c1.
What is the InChIKey of 1-[3-(2,4-dimethylphenyl)phenyl]-2,4-dimethylbenzene?
The InChIKey is JGOWIHSBJATBDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22/c1-15-8-10-21(17(3)12-15)19-6-5-7-20(14-19)22-11-9-16(2)13-18(22)4/h5-14H,1-4H3.
What are the key properties of 1-[3-(2,4-dimethylphenyl)phenyl]-2,4-dimethylbenzene?
1-[3-(2,4-dimethylphenyl)phenyl]-2,4-dimethylbenzene has a molecular weight of 286.42 g/mol, XLogP of 6.25, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2,4-dimethylphenyl)phenyl]-2,4-dimethylbenzene is sourced from PubChem (CID 90996196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).