About N'-[2-[2-[2-(penta-2,4-dienoylamino)ethoxy]ethoxy]ethyl]butanediamide
N'-[2-[2-[2-(penta-2,4-dienoylamino)ethoxy]ethoxy]ethyl]butanediamide (PubChem CID 90996340) has the molecular formula C15H25N3O5
and a molecular weight of 327.38 g/mol. Its IUPAC name is N'-[2-[2-[2-(penta-2,4-dienoylamino)ethoxy]ethoxy]ethyl]butanediamide.
Molecular Properties
| Compound Name | N'-[2-[2-[2-(penta-2,4-dienoylamino)ethoxy]ethoxy]ethyl]butanediamide |
| PubChem CID | 90996340 |
| Molecular Formula | C15H25N3O5 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | N'-[2-[2-[2-(penta-2,4-dienoylamino)ethoxy]ethoxy]ethyl]butanediamide |
| SMILES | C=CC=CC(=O)NCCOCCOCCNC(=O)CCC(N)=O |
| InChI | InChI=1S/C15H25N3O5/c1-2-3-4-14(20)17-7-9-22-11-12-23-10-8-18-15(21)6-5-13(16)19/h2-4H,1,5-12H2,(H2,16,19)(H,17,20)(H,18,21) |
| InChIKey | AJIKUPLBAGGNFT-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-[2-[2-(penta-2,4-dienoylamino)ethoxy]ethoxy]ethyl]butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-[2-[2-(penta-2,4-dienoylamino)ethoxy]ethoxy]ethyl]butanediamide?
The IUPAC name of N'-[2-[2-[2-(penta-2,4-dienoylamino)ethoxy]ethoxy]ethyl]butanediamide (CID 90996340) is N'-[2-[2-[2-(penta-2,4-dienoylamino)ethoxy]ethoxy]ethyl]butanediamide.
What is the SMILES notation for N'-[2-[2-[2-(penta-2,4-dienoylamino)ethoxy]ethoxy]ethyl]butanediamide?
The canonical SMILES for N'-[2-[2-[2-(penta-2,4-dienoylamino)ethoxy]ethoxy]ethyl]butanediamide is C=CC=CC(=O)NCCOCCOCCNC(=O)CCC(N)=O.
What is the InChIKey of N'-[2-[2-[2-(penta-2,4-dienoylamino)ethoxy]ethoxy]ethyl]butanediamide?
The InChIKey is AJIKUPLBAGGNFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O5/c1-2-3-4-14(20)17-7-9-22-11-12-23-10-8-18-15(21)6-5-13(16)19/h2-4H,1,5-12H2,(H2,16,19)(H,17,20)(H,18,21).
What are the key properties of N'-[2-[2-[2-(penta-2,4-dienoylamino)ethoxy]ethoxy]ethyl]butanediamide?
N'-[2-[2-[2-(penta-2,4-dienoylamino)ethoxy]ethoxy]ethyl]butanediamide has a molecular weight of 327.38 g/mol, XLogP of -0.74, 14 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-[2-[2-(penta-2,4-dienoylamino)ethoxy]ethoxy]ethyl]butanediamide is sourced from PubChem (CID 90996340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).