C30H35FN4O4 — CID 90996507
6-cyclopentyl-6-[2-[4-(cyclopropylmethoxy)-3-fluorophenyl]ethyl]-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]oxane-2,4-dione (PubChem CID 90996507) has the molecular formula C30H35FN4O4 and a molecular weight of 534.63 g/mol. Its IUPAC name is 6-cyclopentyl-6-[2-[4-(cyclopropylmethoxy)-3-fluorophenyl]ethyl]-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-6-[2-[4-(cyclopropylmethoxy)-3-fluorophenyl]ethyl]-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 90996507 |
| Molecular Formula | C30H35FN4O4 |
| Molecular Weight | 534.63 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | 6-cyclopentyl-6-[2-[4-(cyclopropylmethoxy)-3-fluorophenyl]ethyl]-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]oxane-2,4-dione |
| SMILES | Cc1cc(C)n2nc(CC3C(=O)CC(CCc4ccc(OCC5CC5)c(F)c4)(C4CCCC4)OC3=O)nc2n1 |
| InChI | InChI=1S/C30H35FN4O4/c1-18-13-19(2)35-29(32-18)33-27(34-35)15-23-25(36)16-30(39-28(23)37,22-5-3-4-6-22)12-11-20-9-10-26(24(31)14-20)38-17-21-7-8-21/h9-10,13-14,21-23H,3-8,11-12,15-17H2,1-2H3 |
| InChIKey | IAQCKPSCDUCZJA-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 95.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.63 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|