C9H8N2O2 — CID 90996584
3,4-dihydro-2H-2,3-benzodiazepine-1,5-dione (PubChem CID 90996584) has the molecular formula C9H8N2O2 and a molecular weight of 176.18 g/mol. Its IUPAC name is 3,4-dihydro-2H-2,3-benzodiazepine-1,5-dione.
| Compound Name | 3,4-dihydro-2H-2,3-benzodiazepine-1,5-dione |
|---|---|
| PubChem CID | 90996584 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 3,4-dihydro-2H-2,3-benzodiazepine-1,5-dione |
| SMILES | O=C1CNNC(=O)c2ccccc21 |
| InChI | InChI=1S/C9H8N2O2/c12-8-5-10-11-9(13)7-4-2-1-3-6(7)8/h1-4,10H,5H2,(H,11,13) |
| InChIKey | CQKTYWYZIGQEIA-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |