About 2-amino-N',N'-bis(2-aminoethyl)butanediamide
2-amino-N',N'-bis(2-aminoethyl)butanediamide (PubChem CID 90996952) has the molecular formula C8H19N5O2
and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-amino-N',N'-bis(2-aminoethyl)butanediamide.
Molecular Properties
| Compound Name | 2-amino-N',N'-bis(2-aminoethyl)butanediamide |
| PubChem CID | 90996952 |
| Molecular Formula | C8H19N5O2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 2-amino-N',N'-bis(2-aminoethyl)butanediamide |
| SMILES | NCCN(CCN)C(=O)CC(N)C(N)=O |
| InChI | InChI=1S/C8H19N5O2/c9-1-3-13(4-2-10)7(14)5-6(11)8(12)15/h6H,1-5,9-11H2,(H2,12,15) |
| InChIKey | LAWAHPLCVFZMOZ-UHFFFAOYSA-N |
| XLogP | -3.06 |
| TPSA | 141.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-N',N'-bis(2-aminoethyl)butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N',N'-bis(2-aminoethyl)butanediamide?
The IUPAC name of 2-amino-N',N'-bis(2-aminoethyl)butanediamide (CID 90996952) is 2-amino-N',N'-bis(2-aminoethyl)butanediamide.
What is the SMILES notation for 2-amino-N',N'-bis(2-aminoethyl)butanediamide?
The canonical SMILES for 2-amino-N',N'-bis(2-aminoethyl)butanediamide is NCCN(CCN)C(=O)CC(N)C(N)=O.
What is the InChIKey of 2-amino-N',N'-bis(2-aminoethyl)butanediamide?
The InChIKey is LAWAHPLCVFZMOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N5O2/c9-1-3-13(4-2-10)7(14)5-6(11)8(12)15/h6H,1-5,9-11H2,(H2,12,15).
What are the key properties of 2-amino-N',N'-bis(2-aminoethyl)butanediamide?
2-amino-N',N'-bis(2-aminoethyl)butanediamide has a molecular weight of 217.27 g/mol, XLogP of -3.06, 7 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N',N'-bis(2-aminoethyl)butanediamide is sourced from PubChem (CID 90996952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).