C25H21F3O6 — CID 90997074
[(3aR,4R,6aS)-2-oxo-4-[3-oxo-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3a,4,5,6-tetrahydro-3H-cyclopenta[b]furan-6a-yl] benzoate (PubChem CID 90997074) has the molecular formula C25H21F3O6 and a molecular weight of 474.43 g/mol. Its IUPAC name is [(3aR,4R,6aS)-2-oxo-4-[3-oxo-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3a,4,5,6-tetrahydro-3H-cyclopenta[b]furan-6a-yl] benzoate.
| Compound Name | [(3aR,4R,6aS)-2-oxo-4-[3-oxo-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3a,4,5,6-tetrahydro-3H-cyclopenta[b]furan-6a-yl] benzoate |
|---|---|
| PubChem CID | 90997074 |
| Molecular Formula | C25H21F3O6 |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | [(3aR,4R,6aS)-2-oxo-4-[3-oxo-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3a,4,5,6-tetrahydro-3H-cyclopenta[b]furan-6a-yl] benzoate |
| SMILES | O=C(C=C[C@H]1CC[C@@]2(OC(=O)c3ccccc3)OC(=O)C[C@H]12)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H21F3O6/c26-25(27,28)18-7-4-8-20(13-18)32-15-19(29)10-9-16-11-12-24(21(16)14-22(30)33-24)34-23(31)17-5-2-1-3-6-17/h1-10,13,16,21H,11-12,14-15H2/t16-,21+,24-/m0/s1 |
| InChIKey | CANSGIFMWIGWGE-FBOFTVOISA-N |
| XLogP | 4.74 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|