C22H21BrN6O6S — CID 90997084
5-(4-bromophenyl)-4-[[furan-2-yl(methyl)sulfamoyl]amino]-6-[2-(5-methoxypyrimidin-2-yl)oxyethoxy]pyrimidine (PubChem CID 90997084) has the molecular formula C22H21BrN6O6S and a molecular weight of 577.42 g/mol. Its IUPAC name is 5-(4-bromophenyl)-4-[[furan-2-yl(methyl)sulfamoyl]amino]-6-[2-(5-methoxypyrimidin-2-yl)oxyethoxy]pyrimidine.
| Compound Name | 5-(4-bromophenyl)-4-[[furan-2-yl(methyl)sulfamoyl]amino]-6-[2-(5-methoxypyrimidin-2-yl)oxyethoxy]pyrimidine |
|---|---|
| PubChem CID | 90997084 |
| Molecular Formula | C22H21BrN6O6S |
| Molecular Weight | 577.42 g/mol |
| Exact Mass | 576.04 |
| IUPAC Name | 5-(4-bromophenyl)-4-[[furan-2-yl(methyl)sulfamoyl]amino]-6-[2-(5-methoxypyrimidin-2-yl)oxyethoxy]pyrimidine |
| SMILES | COc1cnc(OCCOc2ncnc(NS(=O)(=O)N(C)c3ccco3)c2-c2ccc(Br)cc2)nc1 |
| InChI | InChI=1S/C22H21BrN6O6S/c1-29(18-4-3-9-33-18)36(30,31)28-20-19(15-5-7-16(23)8-6-15)21(27-14-26-20)34-10-11-35-22-24-12-17(32-2)13-25-22/h3-9,12-14H,10-11H2,1-2H3,(H,26,27,28) |
| InChIKey | SCCMBDIZRNGJIJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 141.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|