C9H15NO6S — CID 90997385
(2S)-2-[bis(carboxymethyl)amino]-4-methylsulfanylbutanoic acid (PubChem CID 90997385) has the molecular formula C9H15NO6S and a molecular weight of 265.29 g/mol. Its IUPAC name is (2S)-2-[bis(carboxymethyl)amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[bis(carboxymethyl)amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 90997385 |
| Molecular Formula | C9H15NO6S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | (2S)-2-[bis(carboxymethyl)amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](C(=O)O)N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C9H15NO6S/c1-17-3-2-6(9(15)16)10(4-7(11)12)5-8(13)14/h6H,2-5H2,1H3,(H,11,12)(H,13,14)(H,15,16)/t6-/m0/s1 |
| InChIKey | ZUNHQWCLGABDGI-LURJTMIESA-N |
| XLogP | -0.34 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |