C8H11O- — CID 90997735
2-methanidylidene-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan (PubChem CID 90997735) has the molecular formula C8H11O- and a molecular weight of 123.17 g/mol. Its IUPAC name is 2-methanidylidene-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan.
| Compound Name | 2-methanidylidene-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan |
|---|---|
| PubChem CID | 90997735 |
| Molecular Formula | C8H11O- |
| Molecular Weight | 123.17 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | 2-methanidylidene-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan |
| SMILES | [H]/[C-]=C1/CC2CCCC2O1 |
| InChI | InChI=1S/C8H11O/c1-6-5-7-3-2-4-8(7)9-6/h1,7-8H,2-5H2/q-1 |
| InChIKey | BHEKUAOMADYMLH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.17 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|