C25H29ClFNO7S — CID 90998424
2-(cyclohexanecarbonyloxy)ethyl 9-(2-chloro-6-fluorophenyl)-7-methyl-1,1-dioxo-3,5,9,9a-tetrahydro-2H-[1,4]oxathiepino[6,5-b]pyridine-8-carboxylate (PubChem CID 90998424) has the molecular formula C25H29ClFNO7S and a molecular weight of 542.03 g/mol. Its IUPAC name is 2-(cyclohexanecarbonyloxy)ethyl 9-(2-chloro-6-fluorophenyl)-7-methyl-1,1-dioxo-3,5,9,9a-tetrahydro-2H-[1,4]oxathiepino[6,5-b]pyridine-8-carboxylate.
| Compound Name | 2-(cyclohexanecarbonyloxy)ethyl 9-(2-chloro-6-fluorophenyl)-7-methyl-1,1-dioxo-3,5,9,9a-tetrahydro-2H-[1,4]oxathiepino[6,5-b]pyridine-8-carboxylate |
|---|---|
| PubChem CID | 90998424 |
| Molecular Formula | C25H29ClFNO7S |
| Molecular Weight | 542.03 g/mol |
| Exact Mass | 541.13 |
| IUPAC Name | 2-(cyclohexanecarbonyloxy)ethyl 9-(2-chloro-6-fluorophenyl)-7-methyl-1,1-dioxo-3,5,9,9a-tetrahydro-2H-[1,4]oxathiepino[6,5-b]pyridine-8-carboxylate |
| SMILES | CC1=C(C(=O)OCCOC(=O)C2CCCCC2)C(c2c(F)cccc2Cl)C2C(=N1)COCCS2(=O)=O |
| InChI | InChI=1S/C25H29ClFNO7S/c1-15-20(25(30)35-11-10-34-24(29)16-6-3-2-4-7-16)22(21-17(26)8-5-9-18(21)27)23-19(28-15)14-33-12-13-36(23,31)32/h5,8-9,16,22-23H,2-4,6-7,10-14H2,1H3 |
| InChIKey | GQSLYACXYUHVIF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 108.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.03 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|