C11H12F3NO6S — CID 90999343
[1,3-dihydroxy-4-(3-methyloxiran-2-yl)-5,6-dihydro-4H-cyclopenta[c]pyrrol-2-yl] trifluoromethanesulfonate (PubChem CID 90999343) has the molecular formula C11H12F3NO6S and a molecular weight of 343.28 g/mol. Its IUPAC name is [1,3-dihydroxy-4-(3-methyloxiran-2-yl)-5,6-dihydro-4H-cyclopenta[c]pyrrol-2-yl] trifluoromethanesulfonate.
| Compound Name | [1,3-dihydroxy-4-(3-methyloxiran-2-yl)-5,6-dihydro-4H-cyclopenta[c]pyrrol-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 90999343 |
| Molecular Formula | C11H12F3NO6S |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | [1,3-dihydroxy-4-(3-methyloxiran-2-yl)-5,6-dihydro-4H-cyclopenta[c]pyrrol-2-yl] trifluoromethanesulfonate |
| SMILES | CC1OC1C1CCc2c1c(O)n(OS(=O)(=O)C(F)(F)F)c2O |
| InChI | InChI=1S/C11H12F3NO6S/c1-4-8(20-4)5-2-3-6-7(5)10(17)15(9(6)16)21-22(18,19)11(12,13)14/h4-5,8,16-17H,2-3H2,1H3 |
| InChIKey | FDJGOWRGPLHOGV-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|