C21H36O — CID 90999391
2-methyl-6-[(3,3,6-trimethylcycloundecyl)methyl]-2H-pyran (PubChem CID 90999391) has the molecular formula C21H36O and a molecular weight of 304.52 g/mol. Its IUPAC name is 2-methyl-6-[(3,3,6-trimethylcycloundecyl)methyl]-2H-pyran.
| Compound Name | 2-methyl-6-[(3,3,6-trimethylcycloundecyl)methyl]-2H-pyran |
|---|---|
| PubChem CID | 90999391 |
| Molecular Formula | C21H36O |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.28 |
| IUPAC Name | 2-methyl-6-[(3,3,6-trimethylcycloundecyl)methyl]-2H-pyran |
| SMILES | CC1CCCCCC(CC2=CC=CC(C)O2)CC(C)(C)CC1 |
| InChI | InChI=1S/C21H36O/c1-17-9-6-5-7-11-19(16-21(3,4)14-13-17)15-20-12-8-10-18(2)22-20/h8,10,12,17-19H,5-7,9,11,13-16H2,1-4H3 |
| InChIKey | UXCIMRQPYQZNJM-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |