C7H16N4 — CID 90999495
1-(1-ethyl-1,2,4-triazinan-4-yl)ethanimine (PubChem CID 90999495) has the molecular formula C7H16N4 and a molecular weight of 156.23 g/mol. Its IUPAC name is 1-(1-ethyl-1,2,4-triazinan-4-yl)ethanimine.
| Compound Name | 1-(1-ethyl-1,2,4-triazinan-4-yl)ethanimine |
|---|---|
| PubChem CID | 90999495 |
| Molecular Formula | C7H16N4 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.14 |
| IUPAC Name | 1-(1-ethyl-1,2,4-triazinan-4-yl)ethanimine |
| SMILES | [H]/N=C(\C)N1CCN(CC)NC1 |
| InChI | InChI=1S/C7H16N4/c1-3-11-5-4-10(6-9-11)7(2)8/h8-9H,3-6H2,1-2H3/b8-7+ |
| InChIKey | GNZBCERNORGQGF-BQYQJAHWSA-N |
| XLogP | 0.08 |
| TPSA | 42.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|