C18H19N3O3S — CID 90999914
1-(benzenesulfonyl)-4-[[(2R)-pyrrolidin-2-yl]methoxy]indazole (PubChem CID 90999914) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-[[(2R)-pyrrolidin-2-yl]methoxy]indazole.
| Compound Name | 1-(benzenesulfonyl)-4-[[(2R)-pyrrolidin-2-yl]methoxy]indazole |
|---|---|
| PubChem CID | 90999914 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 1-(benzenesulfonyl)-4-[[(2R)-pyrrolidin-2-yl]methoxy]indazole |
| SMILES | O=S(=O)(c1ccccc1)n1ncc2c(OC[C@H]3CCCN3)cccc21 |
| InChI | InChI=1S/C18H19N3O3S/c22-25(23,15-7-2-1-3-8-15)21-17-9-4-10-18(16(17)12-20-21)24-13-14-6-5-11-19-14/h1-4,7-10,12,14,19H,5-6,11,13H2/t14-/m1/s1 |
| InChIKey | KUYOUPWXYPLWGK-CQSZACIVSA-N |
| XLogP | 2.40 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |