About 6-fluoro-N,N-di(propan-2-yl)pyridin-2-amine
6-fluoro-N,N-di(propan-2-yl)pyridin-2-amine (PubChem CID 90999969) has the molecular formula C11H17FN2
and a molecular weight of 196.27 g/mol. Its IUPAC name is 6-fluoro-N,N-di(propan-2-yl)pyridin-2-amine.
Molecular Properties
| Compound Name | 6-fluoro-N,N-di(propan-2-yl)pyridin-2-amine |
| PubChem CID | 90999969 |
| Molecular Formula | C11H17FN2 |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | 6-fluoro-N,N-di(propan-2-yl)pyridin-2-amine |
| SMILES | CC(C)N(c1cccc(F)n1)C(C)C |
| InChI | InChI=1S/C11H17FN2/c1-8(2)14(9(3)4)11-7-5-6-10(12)13-11/h5-9H,1-4H3 |
| InChIKey | AZEDCNCKTARTGA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-N,N-di(propan-2-yl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-N,N-di(propan-2-yl)pyridin-2-amine?
The IUPAC name of 6-fluoro-N,N-di(propan-2-yl)pyridin-2-amine (CID 90999969) is 6-fluoro-N,N-di(propan-2-yl)pyridin-2-amine.
What is the SMILES notation for 6-fluoro-N,N-di(propan-2-yl)pyridin-2-amine?
The canonical SMILES for 6-fluoro-N,N-di(propan-2-yl)pyridin-2-amine is CC(C)N(c1cccc(F)n1)C(C)C.
What is the InChIKey of 6-fluoro-N,N-di(propan-2-yl)pyridin-2-amine?
The InChIKey is AZEDCNCKTARTGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17FN2/c1-8(2)14(9(3)4)11-7-5-6-10(12)13-11/h5-9H,1-4H3.
What are the key properties of 6-fluoro-N,N-di(propan-2-yl)pyridin-2-amine?
6-fluoro-N,N-di(propan-2-yl)pyridin-2-amine has a molecular weight of 196.27 g/mol, XLogP of 2.84, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-N,N-di(propan-2-yl)pyridin-2-amine is sourced from PubChem (CID 90999969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).