About 2-ethenyl-2,3-dimethyloxolane
2-ethenyl-2,3-dimethyloxolane (PubChem CID 91000317) has the molecular formula C8H14O
and a molecular weight of 126.20 g/mol. Its IUPAC name is 2-ethenyl-2,3-dimethyloxolane.
Molecular Properties
| Compound Name | 2-ethenyl-2,3-dimethyloxolane |
| PubChem CID | 91000317 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | 2-ethenyl-2,3-dimethyloxolane |
| SMILES | C=CC1(C)OCCC1C |
| InChI | InChI=1S/C8H14O/c1-4-8(3)7(2)5-6-9-8/h4,7H,1,5-6H2,2-3H3 |
| InChIKey | CHSVTXMCHVRYJM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-2,3-dimethyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-2,3-dimethyloxolane?
The IUPAC name of 2-ethenyl-2,3-dimethyloxolane (CID 91000317) is 2-ethenyl-2,3-dimethyloxolane.
What is the SMILES notation for 2-ethenyl-2,3-dimethyloxolane?
The canonical SMILES for 2-ethenyl-2,3-dimethyloxolane is C=CC1(C)OCCC1C.
What is the InChIKey of 2-ethenyl-2,3-dimethyloxolane?
The InChIKey is CHSVTXMCHVRYJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O/c1-4-8(3)7(2)5-6-9-8/h4,7H,1,5-6H2,2-3H3.
What are the key properties of 2-ethenyl-2,3-dimethyloxolane?
2-ethenyl-2,3-dimethyloxolane has a molecular weight of 126.20 g/mol, XLogP of 1.99, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-2,3-dimethyloxolane is sourced from PubChem (CID 91000317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).