About 1-[5,7-bis(bromomethyl)-2-oxabicyclo[2.2.2]octan-3-yl]-3-phenylhexan-1-one
1-[5,7-bis(bromomethyl)-2-oxabicyclo[2.2.2]octan-3-yl]-3-phenylhexan-1-one (PubChem CID 91000328) has the molecular formula C21H28Br2O2
and a molecular weight of 472.26 g/mol. Its IUPAC name is 1-[5,7-bis(bromomethyl)-2-oxabicyclo[2.2.2]octan-3-yl]-3-phenylhexan-1-one.
Molecular Properties
| Compound Name | 1-[5,7-bis(bromomethyl)-2-oxabicyclo[2.2.2]octan-3-yl]-3-phenylhexan-1-one |
| PubChem CID | 91000328 |
| Molecular Formula | C21H28Br2O2 |
| Molecular Weight | 472.26 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | 1-[5,7-bis(bromomethyl)-2-oxabicyclo[2.2.2]octan-3-yl]-3-phenylhexan-1-one |
| SMILES | CCCC(CC(=O)C1OC2CC(CBr)C1CC2CBr)c1ccccc1 |
| InChI | InChI=1S/C21H28Br2O2/c1-2-6-15(14-7-4-3-5-8-14)10-19(24)21-18-9-17(13-23)20(25-21)11-16(18)12-22/h3-5,7-8,15-18,20-21H,2,6,9-13H2,1H3 |
| InChIKey | INWGYKOXEICJOZ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.26 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[5,7-bis(bromomethyl)-2-oxabicyclo[2.2.2]octan-3-yl]-3-phenylhexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5,7-bis(bromomethyl)-2-oxabicyclo[2.2.2]octan-3-yl]-3-phenylhexan-1-one?
The IUPAC name of 1-[5,7-bis(bromomethyl)-2-oxabicyclo[2.2.2]octan-3-yl]-3-phenylhexan-1-one (CID 91000328) is 1-[5,7-bis(bromomethyl)-2-oxabicyclo[2.2.2]octan-3-yl]-3-phenylhexan-1-one.
What is the SMILES notation for 1-[5,7-bis(bromomethyl)-2-oxabicyclo[2.2.2]octan-3-yl]-3-phenylhexan-1-one?
The canonical SMILES for 1-[5,7-bis(bromomethyl)-2-oxabicyclo[2.2.2]octan-3-yl]-3-phenylhexan-1-one is CCCC(CC(=O)C1OC2CC(CBr)C1CC2CBr)c1ccccc1.
What is the InChIKey of 1-[5,7-bis(bromomethyl)-2-oxabicyclo[2.2.2]octan-3-yl]-3-phenylhexan-1-one?
The InChIKey is INWGYKOXEICJOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28Br2O2/c1-2-6-15(14-7-4-3-5-8-14)10-19(24)21-18-9-17(13-23)20(25-21)11-16(18)12-22/h3-5,7-8,15-18,20-21H,2,6,9-13H2,1H3.
What are the key properties of 1-[5,7-bis(bromomethyl)-2-oxabicyclo[2.2.2]octan-3-yl]-3-phenylhexan-1-one?
1-[5,7-bis(bromomethyl)-2-oxabicyclo[2.2.2]octan-3-yl]-3-phenylhexan-1-one has a molecular weight of 472.26 g/mol, XLogP of 5.73, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5,7-bis(bromomethyl)-2-oxabicyclo[2.2.2]octan-3-yl]-3-phenylhexan-1-one is sourced from PubChem (CID 91000328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).