About 7H-benzo[e]indole
7H-benzo[e]indole (PubChem CID 91000731) has the molecular formula C12H9N
and a molecular weight of 167.21 g/mol. Its IUPAC name is 7H-benzo[e]indole.
Molecular Properties
| Compound Name | 7H-benzo[e]indole |
| PubChem CID | 91000731 |
| Molecular Formula | C12H9N |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 7H-benzo[e]indole |
| SMILES | C1=Cc2c3c(ccc2=CC1)=NC=C3 |
| InChI | InChI=1S/C12H9N/c1-2-4-10-9(3-1)5-6-12-11(10)7-8-13-12/h2-8H,1H2 |
| InChIKey | ZKVQSJCGDFFVIL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7H-benzo[e]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-benzo[e]indole?
The IUPAC name of 7H-benzo[e]indole (CID 91000731) is 7H-benzo[e]indole.
What is the SMILES notation for 7H-benzo[e]indole?
The canonical SMILES for 7H-benzo[e]indole is C1=Cc2c3c(ccc2=CC1)=NC=C3.
What is the InChIKey of 7H-benzo[e]indole?
The InChIKey is ZKVQSJCGDFFVIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N/c1-2-4-10-9(3-1)5-6-12-11(10)7-8-13-12/h2-8H,1H2.
What are the key properties of 7H-benzo[e]indole?
7H-benzo[e]indole has a molecular weight of 167.21 g/mol, XLogP of 1.49, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-benzo[e]indole is sourced from PubChem (CID 91000731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).