C24H18F6O2S — CID 91000743
3-[3,3,4,4,5,5-hexafluoro-2-(2-methoxyphenyl)cyclopenten-1-yl]-5-(4-methoxyphenyl)-2-methylthiophene (PubChem CID 91000743) has the molecular formula C24H18F6O2S and a molecular weight of 484.46 g/mol. Its IUPAC name is 3-[3,3,4,4,5,5-hexafluoro-2-(2-methoxyphenyl)cyclopenten-1-yl]-5-(4-methoxyphenyl)-2-methylthiophene.
| Compound Name | 3-[3,3,4,4,5,5-hexafluoro-2-(2-methoxyphenyl)cyclopenten-1-yl]-5-(4-methoxyphenyl)-2-methylthiophene |
|---|---|
| PubChem CID | 91000743 |
| Molecular Formula | C24H18F6O2S |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | 3-[3,3,4,4,5,5-hexafluoro-2-(2-methoxyphenyl)cyclopenten-1-yl]-5-(4-methoxyphenyl)-2-methylthiophene |
| SMILES | COc1ccc(-c2cc(C3=C(c4ccccc4OC)C(F)(F)C(F)(F)C3(F)F)c(C)s2)cc1 |
| InChI | InChI=1S/C24H18F6O2S/c1-13-17(12-19(33-13)14-8-10-15(31-2)11-9-14)21-20(16-6-4-5-7-18(16)32-3)22(25,26)24(29,30)23(21,27)28/h4-12H,1-3H3 |
| InChIKey | PBRFRLZUMNANMZ-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|