C32H31FN2O2 — CID 91001214
2-fluoro-N-[(1R,2R)-2-hydroxy-6-[[2-(4-methylphenyl)ethylamino]methyl]-2,3-dihydro-1H-inden-1-yl]-4-phenylbenzamide (PubChem CID 91001214) has the molecular formula C32H31FN2O2 and a molecular weight of 494.61 g/mol. Its IUPAC name is 2-fluoro-N-[(1R,2R)-2-hydroxy-6-[[2-(4-methylphenyl)ethylamino]methyl]-2,3-dihydro-1H-inden-1-yl]-4-phenylbenzamide.
| Compound Name | 2-fluoro-N-[(1R,2R)-2-hydroxy-6-[[2-(4-methylphenyl)ethylamino]methyl]-2,3-dihydro-1H-inden-1-yl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 91001214 |
| Molecular Formula | C32H31FN2O2 |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 2-fluoro-N-[(1R,2R)-2-hydroxy-6-[[2-(4-methylphenyl)ethylamino]methyl]-2,3-dihydro-1H-inden-1-yl]-4-phenylbenzamide |
| SMILES | Cc1ccc(CCNCc2ccc3c(c2)[C@@H](NC(=O)c2ccc(-c4ccccc4)cc2F)[C@H](O)C3)cc1 |
| InChI | InChI=1S/C32H31FN2O2/c1-21-7-9-22(10-8-21)15-16-34-20-23-11-12-26-19-30(36)31(28(26)17-23)35-32(37)27-14-13-25(18-29(27)33)24-5-3-2-4-6-24/h2-14,17-18,30-31,34,36H,15-16,19-20H2,1H3,(H,35,37)/t30-,31-/m1/s1 |
| InChIKey | QPYFTKVNOLRTCQ-FIRIVFDPSA-N |
| XLogP | 5.52 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|