C20H25N3OS — CID 9100145
N-(3-methylsulfanylphenyl)-2-(2-piperidin-1-ylanilino)acetamide (PubChem CID 9100145) has the molecular formula C20H25N3OS and a molecular weight of 355.51 g/mol. Its IUPAC name is N-(3-methylsulfanylphenyl)-2-(2-piperidin-1-ylanilino)acetamide.
| Compound Name | N-(3-methylsulfanylphenyl)-2-(2-piperidin-1-ylanilino)acetamide |
|---|---|
| PubChem CID | 9100145 |
| Molecular Formula | C20H25N3OS |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | N-(3-methylsulfanylphenyl)-2-(2-piperidin-1-ylanilino)acetamide |
| SMILES | CSc1cccc(NC(=O)CNc2ccccc2N2CCCCC2)c1 |
| InChI | InChI=1S/C20H25N3OS/c1-25-17-9-7-8-16(14-17)22-20(24)15-21-18-10-3-4-11-19(18)23-12-5-2-6-13-23/h3-4,7-11,14,21H,2,5-6,12-13,15H2,1H3,(H,22,24) |
| InChIKey | SSDVHRFXTCFWBV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |