C25H48O8P2S — CID 91001499
butan-2-ylphosphonic acid;2-(2,2-dimethylbutanoyloxy)ethyl-triethylphosphanium;4-methylbenzenesulfonate (PubChem CID 91001499) has the molecular formula C25H48O8P2S and a molecular weight of 570.67 g/mol. Its IUPAC name is butan-2-ylphosphonic acid;2-(2,2-dimethylbutanoyloxy)ethyl-triethylphosphanium;4-methylbenzenesulfonate.
| Compound Name | butan-2-ylphosphonic acid;2-(2,2-dimethylbutanoyloxy)ethyl-triethylphosphanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 91001499 |
| Molecular Formula | C25H48O8P2S |
| Molecular Weight | 570.67 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | butan-2-ylphosphonic acid;2-(2,2-dimethylbutanoyloxy)ethyl-triethylphosphanium;4-methylbenzenesulfonate |
| SMILES | CCC(C)(C)C(=O)OCC[P+](CC)(CC)CC.CCC(C)P(=O)(O)O.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C14H30O2P.C7H8O3S.C4H11O3P/c1-7-14(5,6)13(15)16-11-12-17(8-2,9-3)10-4;1-6-2-4-7(5-3-6)11(8,9)10;1-3-4(2)8(5,6)7/h7-12H2,1-6H3;2-5H,1H3,(H,8,9,10);4H,3H2,1-2H3,(H2,5,6,7)/q+1;;/p-1 |
| InChIKey | XYMXFYIFMWEIQQ-UHFFFAOYSA-M |
| XLogP | 5.90 |
| TPSA | 141.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.67 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|