C60H66N10 — CID 91001821
1-methyl-3-[4-[4-(6-methylquinolin-8-yl)piperazin-1-yl]cyclohexyl]indole-5-carbonitrile (PubChem CID 91001821) has the molecular formula C60H66N10 and a molecular weight of 927.26 g/mol. Its IUPAC name is 1-methyl-3-[4-[4-(6-methylquinolin-8-yl)piperazin-1-yl]cyclohexyl]indole-5-carbonitrile.
| Compound Name | 1-methyl-3-[4-[4-(6-methylquinolin-8-yl)piperazin-1-yl]cyclohexyl]indole-5-carbonitrile |
|---|---|
| PubChem CID | 91001821 |
| Molecular Formula | C60H66N10 |
| Molecular Weight | 927.26 g/mol |
| Exact Mass | 926.55 |
| IUPAC Name | 1-methyl-3-[4-[4-(6-methylquinolin-8-yl)piperazin-1-yl]cyclohexyl]indole-5-carbonitrile |
| SMILES | Cc1cc(N2CCN(C3CCC(c4cn(C)c5ccc(C#N)cc45)CC3)CC2)c2ncccc2c1.Cc1cc(N2CCN(C3CCC(c4cn(C)c5ccc(C#N)cc45)CC3)CC2)c2ncccc2c1 |
| InChI | InChI=1S/2C30H33N5/c2*1-21-16-24-4-3-11-32-30(24)29(17-21)35-14-12-34(13-15-35)25-8-6-23(7-9-25)27-20-33(2)28-10-5-22(19-31)18-26(27)28/h2*3-5,10-11,16-18,20,23,25H,6-9,12-15H2,1-2H3 |
| InChIKey | RGYOCQCAEDVWDA-UHFFFAOYSA-N |
| XLogP | 11.51 |
| TPSA | 96.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 927.26 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |