About cyclobuten-1-yl 1H-imidazole-2-carboxylate
cyclobuten-1-yl 1H-imidazole-2-carboxylate (PubChem CID 91002569) has the molecular formula C8H8N2O2
and a molecular weight of 164.16 g/mol. Its IUPAC name is cyclobuten-1-yl 1H-imidazole-2-carboxylate.
Molecular Properties
| Compound Name | cyclobuten-1-yl 1H-imidazole-2-carboxylate |
| PubChem CID | 91002569 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | cyclobuten-1-yl 1H-imidazole-2-carboxylate |
| SMILES | O=C(OC1=CCC1)c1ncc[nH]1 |
| InChI | InChI=1S/C8H8N2O2/c11-8(7-9-4-5-10-7)12-6-2-1-3-6/h2,4-5H,1,3H2,(H,9,10) |
| InChIKey | CCWBVFYTFNOPKA-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclobuten-1-yl 1H-imidazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobuten-1-yl 1H-imidazole-2-carboxylate?
The IUPAC name of cyclobuten-1-yl 1H-imidazole-2-carboxylate (CID 91002569) is cyclobuten-1-yl 1H-imidazole-2-carboxylate.
What is the SMILES notation for cyclobuten-1-yl 1H-imidazole-2-carboxylate?
The canonical SMILES for cyclobuten-1-yl 1H-imidazole-2-carboxylate is O=C(OC1=CCC1)c1ncc[nH]1.
What is the InChIKey of cyclobuten-1-yl 1H-imidazole-2-carboxylate?
The InChIKey is CCWBVFYTFNOPKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2/c11-8(7-9-4-5-10-7)12-6-2-1-3-6/h2,4-5H,1,3H2,(H,9,10).
What are the key properties of cyclobuten-1-yl 1H-imidazole-2-carboxylate?
cyclobuten-1-yl 1H-imidazole-2-carboxylate has a molecular weight of 164.16 g/mol, XLogP of 1.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobuten-1-yl 1H-imidazole-2-carboxylate is sourced from PubChem (CID 91002569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).