About ethane;4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine
ethane;4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine (PubChem CID 91002841) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is ethane;4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine.
Analyze ethane;4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine?
The IUPAC name of ethane;4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine (CID 91002841) is ethane;4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine.
What is the SMILES notation for ethane;4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine?
The canonical SMILES for ethane;4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine is CC.c1cc2n(n1)CCCC2.
What is the InChIKey of ethane;4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine?
The InChIKey is HLNFDZIPPJTXQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.C2H6/c1-2-6-9-7(3-1)4-5-8-9;1-2/h4-5H,1-3,6H2;1-2H3.
What are the key properties of ethane;4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine?
ethane;4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine has a molecular weight of 152.24 g/mol, XLogP of 2.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine is sourced from PubChem (CID 91002841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).