C12H12FNO — CID 91003107
3-[(4-fluorocyclohepta-1,2,3,5-tetraen-1-yl)methyl]-4-iminobutan-2-one (PubChem CID 91003107) has the molecular formula C12H12FNO and a molecular weight of 205.23 g/mol. Its IUPAC name is 3-[(4-fluorocyclohepta-1,2,3,5-tetraen-1-yl)methyl]-4-iminobutan-2-one.
| Compound Name | 3-[(4-fluorocyclohepta-1,2,3,5-tetraen-1-yl)methyl]-4-iminobutan-2-one |
|---|---|
| PubChem CID | 91003107 |
| Molecular Formula | C12H12FNO |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 3-[(4-fluorocyclohepta-1,2,3,5-tetraen-1-yl)methyl]-4-iminobutan-2-one |
| SMILES | [H]/N=C/C(CC1=C=C=C(F)C=CC1)C(C)=O |
| InChI | InChI=1S/C12H12FNO/c1-9(15)11(8-14)7-10-3-2-4-12(13)6-5-10/h2,4,8,11,14H,3,7H2,1H3/b14-8+ |
| InChIKey | JBFFUEAFNDIEAM-RIYZIHGNSA-N |
| XLogP | 2.72 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|