About N-[(2S)-1-(3,4-difluorophenyl)-2-methoxypropylidene]hydroxylamine
N-[(2S)-1-(3,4-difluorophenyl)-2-methoxypropylidene]hydroxylamine (PubChem CID 91003246) has the molecular formula C10H11F2NO2
and a molecular weight of 215.20 g/mol. Its IUPAC name is N-[(2S)-1-(3,4-difluorophenyl)-2-methoxypropylidene]hydroxylamine.
Molecular Properties
| Compound Name | N-[(2S)-1-(3,4-difluorophenyl)-2-methoxypropylidene]hydroxylamine |
| PubChem CID | 91003246 |
| Molecular Formula | C10H11F2NO2 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | N-[(2S)-1-(3,4-difluorophenyl)-2-methoxypropylidene]hydroxylamine |
| SMILES | CO[C@@H](C)C(=NO)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H11F2NO2/c1-6(15-2)10(13-14)7-3-4-8(11)9(12)5-7/h3-6,14H,1-2H3/t6-/m0/s1 |
| InChIKey | RKKWZJBTYNOTMW-LURJTMIESA-N |
| XLogP | 2.18 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(2S)-1-(3,4-difluorophenyl)-2-methoxypropylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-1-(3,4-difluorophenyl)-2-methoxypropylidene]hydroxylamine?
The IUPAC name of N-[(2S)-1-(3,4-difluorophenyl)-2-methoxypropylidene]hydroxylamine (CID 91003246) is N-[(2S)-1-(3,4-difluorophenyl)-2-methoxypropylidene]hydroxylamine.
What is the SMILES notation for N-[(2S)-1-(3,4-difluorophenyl)-2-methoxypropylidene]hydroxylamine?
The canonical SMILES for N-[(2S)-1-(3,4-difluorophenyl)-2-methoxypropylidene]hydroxylamine is CO[C@@H](C)C(=NO)c1ccc(F)c(F)c1.
What is the InChIKey of N-[(2S)-1-(3,4-difluorophenyl)-2-methoxypropylidene]hydroxylamine?
The InChIKey is RKKWZJBTYNOTMW-LURJTMIESA-N. The full InChI is InChI=1S/C10H11F2NO2/c1-6(15-2)10(13-14)7-3-4-8(11)9(12)5-7/h3-6,14H,1-2H3/t6-/m0/s1.
What are the key properties of N-[(2S)-1-(3,4-difluorophenyl)-2-methoxypropylidene]hydroxylamine?
N-[(2S)-1-(3,4-difluorophenyl)-2-methoxypropylidene]hydroxylamine has a molecular weight of 215.20 g/mol, XLogP of 2.18, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-1-(3,4-difluorophenyl)-2-methoxypropylidene]hydroxylamine is sourced from PubChem (CID 91003246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).