C9H14N2 — CID 91003316
4a,5,6,7,8,9-hexahydro-2H-pyrido[3,2-c]azepine (PubChem CID 91003316) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 4a,5,6,7,8,9-hexahydro-2H-pyrido[3,2-c]azepine.
| Compound Name | 4a,5,6,7,8,9-hexahydro-2H-pyrido[3,2-c]azepine |
|---|---|
| PubChem CID | 91003316 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 4a,5,6,7,8,9-hexahydro-2H-pyrido[3,2-c]azepine |
| SMILES | C1=CC2CNCCCC2=NC1 |
| InChI | InChI=1S/C9H14N2/c1-3-8-7-10-5-2-4-9(8)11-6-1/h1,3,8,10H,2,4-7H2 |
| InChIKey | RIDONKLHDNSOPB-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|