C13H22O — CID 91003548
7-methyl-2,3,4,4a,5,6,7,8,9,10a-decahydro-1H-benzo[8]annulen-10-one (PubChem CID 91003548) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is 7-methyl-2,3,4,4a,5,6,7,8,9,10a-decahydro-1H-benzo[8]annulen-10-one.
| Compound Name | 7-methyl-2,3,4,4a,5,6,7,8,9,10a-decahydro-1H-benzo[8]annulen-10-one |
|---|---|
| PubChem CID | 91003548 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 7-methyl-2,3,4,4a,5,6,7,8,9,10a-decahydro-1H-benzo[8]annulen-10-one |
| SMILES | CC1CCC(=O)C2CCCCC2CC1 |
| InChI | InChI=1S/C13H22O/c1-10-6-8-11-4-2-3-5-12(11)13(14)9-7-10/h10-12H,2-9H2,1H3 |
| InChIKey | FNTISKPHEWSZHT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |