C15H18F3NO4 — CID 91003614
(2S)-2-amino-3-[(2-methylpropan-2-yl)oxy]-3-oxo-2-[[4-(trifluoromethyl)phenyl]methyl]propanoic acid (PubChem CID 91003614) has the molecular formula C15H18F3NO4 and a molecular weight of 333.31 g/mol. Its IUPAC name is (2S)-2-amino-3-[(2-methylpropan-2-yl)oxy]-3-oxo-2-[[4-(trifluoromethyl)phenyl]methyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[(2-methylpropan-2-yl)oxy]-3-oxo-2-[[4-(trifluoromethyl)phenyl]methyl]propanoic acid |
|---|---|
| PubChem CID | 91003614 |
| Molecular Formula | C15H18F3NO4 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (2S)-2-amino-3-[(2-methylpropan-2-yl)oxy]-3-oxo-2-[[4-(trifluoromethyl)phenyl]methyl]propanoic acid |
| SMILES | CC(C)(C)OC(=O)[C@](N)(Cc1ccc(C(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C15H18F3NO4/c1-13(2,3)23-12(22)14(19,11(20)21)8-9-4-6-10(7-5-9)15(16,17)18/h4-7H,8,19H2,1-3H3,(H,20,21)/t14-/m0/s1 |
| InChIKey | RDIZQXGXLJATEI-AWEZNQCLSA-N |
| XLogP | 2.37 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|