C28H32ClN3O4 — CID 91003626
[(1S)-5-[3-[[2-chloro-5-(4-methoxyphenyl)pyrimidin-4-yl]-methylamino]propoxy]-2,3-dihydro-1H-inden-1-yl] butanoate (PubChem CID 91003626) has the molecular formula C28H32ClN3O4 and a molecular weight of 510.03 g/mol. Its IUPAC name is [(1S)-5-[3-[[2-chloro-5-(4-methoxyphenyl)pyrimidin-4-yl]-methylamino]propoxy]-2,3-dihydro-1H-inden-1-yl] butanoate.
| Compound Name | [(1S)-5-[3-[[2-chloro-5-(4-methoxyphenyl)pyrimidin-4-yl]-methylamino]propoxy]-2,3-dihydro-1H-inden-1-yl] butanoate |
|---|---|
| PubChem CID | 91003626 |
| Molecular Formula | C28H32ClN3O4 |
| Molecular Weight | 510.03 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | [(1S)-5-[3-[[2-chloro-5-(4-methoxyphenyl)pyrimidin-4-yl]-methylamino]propoxy]-2,3-dihydro-1H-inden-1-yl] butanoate |
| SMILES | CCCC(=O)O[C@H]1CCc2cc(OCCCN(C)c3nc(Cl)ncc3-c3ccc(OC)cc3)ccc21 |
| InChI | InChI=1S/C28H32ClN3O4/c1-4-6-26(33)36-25-14-9-20-17-22(12-13-23(20)25)35-16-5-15-32(2)27-24(18-30-28(29)31-27)19-7-10-21(34-3)11-8-19/h7-8,10-13,17-18,25H,4-6,9,14-16H2,1-3H3/t25-/m0/s1 |
| InChIKey | PAIIEFGQCCRZGK-VWLOTQADSA-N |
| XLogP | 6.04 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.03 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|