About methoxy(methoxymethoxymethoxymethoxy)methane;methoxymethoxymethoxymethyl methyl carbonate
methoxy(methoxymethoxymethoxymethoxy)methane;methoxymethoxymethoxymethyl methyl carbonate (PubChem CID 91003929) has the molecular formula C12H26O11
and a molecular weight of 346.33 g/mol. Its IUPAC name is methoxy(methoxymethoxymethoxymethoxy)methane;methoxymethoxymethoxymethyl methyl carbonate.
Molecular Properties
| Compound Name | methoxy(methoxymethoxymethoxymethoxy)methane;methoxymethoxymethoxymethyl methyl carbonate |
| PubChem CID | 91003929 |
| Molecular Formula | C12H26O11 |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | methoxy(methoxymethoxymethoxymethoxy)methane;methoxymethoxymethoxymethyl methyl carbonate |
| SMILES | COCOCOCOC(=O)OC.COCOCOCOCOC |
| InChI | InChI=1S/C6H12O6.C6H14O5/c1-8-3-10-4-11-5-12-6(7)9-2;1-7-3-9-5-11-6-10-4-8-2/h3-5H2,1-2H3;3-6H2,1-2H3 |
| InChIKey | SNBAANHPGLHCIJ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methoxy(methoxymethoxymethoxymethoxy)methane;methoxymethoxymethoxymethyl methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxy(methoxymethoxymethoxymethoxy)methane;methoxymethoxymethoxymethyl methyl carbonate?
The IUPAC name of methoxy(methoxymethoxymethoxymethoxy)methane;methoxymethoxymethoxymethyl methyl carbonate (CID 91003929) is methoxy(methoxymethoxymethoxymethoxy)methane;methoxymethoxymethoxymethyl methyl carbonate.
What is the SMILES notation for methoxy(methoxymethoxymethoxymethoxy)methane;methoxymethoxymethoxymethyl methyl carbonate?
The canonical SMILES for methoxy(methoxymethoxymethoxymethoxy)methane;methoxymethoxymethoxymethyl methyl carbonate is COCOCOCOC(=O)OC.COCOCOCOCOC.
What is the InChIKey of methoxy(methoxymethoxymethoxymethoxy)methane;methoxymethoxymethoxymethyl methyl carbonate?
The InChIKey is SNBAANHPGLHCIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O6.C6H14O5/c1-8-3-10-4-11-5-12-6(7)9-2;1-7-3-9-5-11-6-10-4-8-2/h3-5H2,1-2H3;3-6H2,1-2H3.
What are the key properties of methoxy(methoxymethoxymethoxymethoxy)methane;methoxymethoxymethoxymethyl methyl carbonate?
methoxy(methoxymethoxymethoxymethoxy)methane;methoxymethoxymethoxymethyl methyl carbonate has a molecular weight of 346.33 g/mol, XLogP of 0.48, 14 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for methoxy(methoxymethoxymethoxymethoxy)methane;methoxymethoxymethoxymethyl methyl carbonate is sourced from PubChem (CID 91003929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).