About 3-methylanthracene-1,2,4,8-tetrol
3-methylanthracene-1,2,4,8-tetrol (PubChem CID 91004047) has the molecular formula C15H12O4
and a molecular weight of 256.26 g/mol. Its IUPAC name is 3-methylanthracene-1,2,4,8-tetrol.
Molecular Properties
| Compound Name | 3-methylanthracene-1,2,4,8-tetrol |
| PubChem CID | 91004047 |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 3-methylanthracene-1,2,4,8-tetrol |
| SMILES | Cc1c(O)c(O)c2cc3c(O)cccc3cc2c1O |
| InChI | InChI=1S/C15H12O4/c1-7-13(17)10-5-8-3-2-4-12(16)9(8)6-11(10)15(19)14(7)18/h2-6,16-19H,1H3 |
| InChIKey | NOGVRVIQHWEDMG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3-methylanthracene-1,2,4,8-tetrol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylanthracene-1,2,4,8-tetrol?
The IUPAC name of 3-methylanthracene-1,2,4,8-tetrol (CID 91004047) is 3-methylanthracene-1,2,4,8-tetrol.
What is the SMILES notation for 3-methylanthracene-1,2,4,8-tetrol?
The canonical SMILES for 3-methylanthracene-1,2,4,8-tetrol is Cc1c(O)c(O)c2cc3c(O)cccc3cc2c1O.
What is the InChIKey of 3-methylanthracene-1,2,4,8-tetrol?
The InChIKey is NOGVRVIQHWEDMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O4/c1-7-13(17)10-5-8-3-2-4-12(16)9(8)6-11(10)15(19)14(7)18/h2-6,16-19H,1H3.
What are the key properties of 3-methylanthracene-1,2,4,8-tetrol?
3-methylanthracene-1,2,4,8-tetrol has a molecular weight of 256.26 g/mol, XLogP of 3.12, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylanthracene-1,2,4,8-tetrol is sourced from PubChem (CID 91004047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).