C20H19ClFN3OS — CID 91004074
1-[4-[1,3-benzothiazol-6-yl-(2-chlorophenyl)-fluoromethyl]piperazin-1-yl]ethanone (PubChem CID 91004074) has the molecular formula C20H19ClFN3OS and a molecular weight of 403.91 g/mol. Its IUPAC name is 1-[4-[1,3-benzothiazol-6-yl-(2-chlorophenyl)-fluoromethyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[1,3-benzothiazol-6-yl-(2-chlorophenyl)-fluoromethyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 91004074 |
| Molecular Formula | C20H19ClFN3OS |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 1-[4-[1,3-benzothiazol-6-yl-(2-chlorophenyl)-fluoromethyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C(F)(c2ccc3ncsc3c2)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C20H19ClFN3OS/c1-14(26)24-8-10-25(11-9-24)20(22,16-4-2-3-5-17(16)21)15-6-7-18-19(12-15)27-13-23-18/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | FKSRZQAIOONCRM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|