About 1-[4-[1,3-benzothiazol-6-yl-(2-chlorophenyl)-fluoromethyl]piperazin-1-yl]ethanone
1-[4-[1,3-benzothiazol-6-yl-(2-chlorophenyl)-fluoromethyl]piperazin-1-yl]ethanone (PubChem CID 91004074) has the molecular formula C20H19ClFN3OS
and a molecular weight of 403.91 g/mol. Its IUPAC name is 1-[4-[1,3-benzothiazol-6-yl-(2-chlorophenyl)-fluoromethyl]piperazin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-[1,3-benzothiazol-6-yl-(2-chlorophenyl)-fluoromethyl]piperazin-1-yl]ethanone |
| PubChem CID | 91004074 |
| Molecular Formula | C20H19ClFN3OS |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 1-[4-[1,3-benzothiazol-6-yl-(2-chlorophenyl)-fluoromethyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C(F)(c2ccc3ncsc3c2)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C20H19ClFN3OS/c1-14(26)24-8-10-25(11-9-24)20(22,16-4-2-3-5-17(16)21)15-6-7-18-19(12-15)27-13-23-18/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | FKSRZQAIOONCRM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[1,3-benzothiazol-6-yl-(2-chlorophenyl)-fluoromethyl]piperazin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[1,3-benzothiazol-6-yl-(2-chlorophenyl)-fluoromethyl]piperazin-1-yl]ethanone?
The IUPAC name of 1-[4-[1,3-benzothiazol-6-yl-(2-chlorophenyl)-fluoromethyl]piperazin-1-yl]ethanone (CID 91004074) is 1-[4-[1,3-benzothiazol-6-yl-(2-chlorophenyl)-fluoromethyl]piperazin-1-yl]ethanone.
What is the SMILES notation for 1-[4-[1,3-benzothiazol-6-yl-(2-chlorophenyl)-fluoromethyl]piperazin-1-yl]ethanone?
The canonical SMILES for 1-[4-[1,3-benzothiazol-6-yl-(2-chlorophenyl)-fluoromethyl]piperazin-1-yl]ethanone is CC(=O)N1CCN(C(F)(c2ccc3ncsc3c2)c2ccccc2Cl)CC1.
What is the InChIKey of 1-[4-[1,3-benzothiazol-6-yl-(2-chlorophenyl)-fluoromethyl]piperazin-1-yl]ethanone?
The InChIKey is FKSRZQAIOONCRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19ClFN3OS/c1-14(26)24-8-10-25(11-9-24)20(22,16-4-2-3-5-17(16)21)15-6-7-18-19(12-15)27-13-23-18/h2-7,12-13H,8-11H2,1H3.
What are the key properties of 1-[4-[1,3-benzothiazol-6-yl-(2-chlorophenyl)-fluoromethyl]piperazin-1-yl]ethanone?
1-[4-[1,3-benzothiazol-6-yl-(2-chlorophenyl)-fluoromethyl]piperazin-1-yl]ethanone has a molecular weight of 403.91 g/mol, XLogP of 4.28, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[1,3-benzothiazol-6-yl-(2-chlorophenyl)-fluoromethyl]piperazin-1-yl]ethanone is sourced from PubChem (CID 91004074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).