About N-benzyl-1,2-oxazole-5-carboxamide
N-benzyl-1,2-oxazole-5-carboxamide (PubChem CID 91004792) has the molecular formula C11H10N2O2
and a molecular weight of 202.21 g/mol. Its IUPAC name is N-benzyl-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-benzyl-1,2-oxazole-5-carboxamide |
| PubChem CID | 91004792 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | N-benzyl-1,2-oxazole-5-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1ccno1 |
| InChI | InChI=1S/C11H10N2O2/c14-11(10-6-7-13-15-10)12-8-9-4-2-1-3-5-9/h1-7H,8H2,(H,12,14) |
| InChIKey | DXWZXERUKHTNGF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-1,2-oxazole-5-carboxamide?
The IUPAC name of N-benzyl-1,2-oxazole-5-carboxamide (CID 91004792) is N-benzyl-1,2-oxazole-5-carboxamide.
What is the SMILES notation for N-benzyl-1,2-oxazole-5-carboxamide?
The canonical SMILES for N-benzyl-1,2-oxazole-5-carboxamide is O=C(NCc1ccccc1)c1ccno1.
What is the InChIKey of N-benzyl-1,2-oxazole-5-carboxamide?
The InChIKey is DXWZXERUKHTNGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2/c14-11(10-6-7-13-15-10)12-8-9-4-2-1-3-5-9/h1-7H,8H2,(H,12,14).
What are the key properties of N-benzyl-1,2-oxazole-5-carboxamide?
N-benzyl-1,2-oxazole-5-carboxamide has a molecular weight of 202.21 g/mol, XLogP of 1.60, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 91004792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).