C50H80N8 — CID 91005763
N'-[3-[8,13-diethyl-18-[3-[ethyl-[4-(ethylamino)butyl]amino]propyl]-3,7,12,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propyl]-N,N'-diethylbutane-1,4-diamine (PubChem CID 91005763) has the molecular formula C50H80N8 and a molecular weight of 793.25 g/mol. Its IUPAC name is N'-[3-[8,13-diethyl-18-[3-[ethyl-[4-(ethylamino)butyl]amino]propyl]-3,7,12,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propyl]-N,N'-diethylbutane-1,4-diamine.
| Compound Name | N'-[3-[8,13-diethyl-18-[3-[ethyl-[4-(ethylamino)butyl]amino]propyl]-3,7,12,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propyl]-N,N'-diethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 91005763 |
| Molecular Formula | C50H80N8 |
| Molecular Weight | 793.25 g/mol |
| Exact Mass | 792.65 |
| IUPAC Name | N'-[3-[8,13-diethyl-18-[3-[ethyl-[4-(ethylamino)butyl]amino]propyl]-3,7,12,17-tetramethyl-21,22,23,24-tetrahydroporphyrin-2-yl]propyl]-N,N'-diethylbutane-1,4-diamine |
| SMILES | CCNCCCCN(CC)CCCc1c2[nH]c(c1C)C=c1[nH]c(c(C)c1CC)=Cc1[nH]c(c(C)c1CC)C=c1[nH]c(c(CCCN(CC)CCCCNCC)c1C)=C2 |
| InChI | InChI=1S/C50H80N8/c1-11-39-35(7)43-31-44-37(9)41(23-21-29-57(15-5)27-19-17-25-51-13-3)49(55-44)34-50-42(24-22-30-58(16-6)28-20-18-26-52-14-4)38(10)46(56-50)33-48-40(12-2)36(8)45(54-48)32-47(39)53-43/h31-34,51-56H,11-30H2,1-10H3 |
| InChIKey | DWLPGUUKDXZCIA-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.25 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|