C17H15F4N3O2 — CID 91005801
N-[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]-3-(trifluoromethyl)pyrrolidine-1-carboxamide (PubChem CID 91005801) has the molecular formula C17H15F4N3O2 and a molecular weight of 369.32 g/mol. Its IUPAC name is N-[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]-3-(trifluoromethyl)pyrrolidine-1-carboxamide.
| Compound Name | N-[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]-3-(trifluoromethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 91005801 |
| Molecular Formula | C17H15F4N3O2 |
| Molecular Weight | 369.32 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | N-[2-fluoro-4-(2-oxo-1-pyridinyl)phenyl]-3-(trifluoromethyl)pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(-n2ccccc2=O)cc1F)N1CCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C17H15F4N3O2/c18-13-9-12(24-7-2-1-3-15(24)25)4-5-14(13)22-16(26)23-8-6-11(10-23)17(19,20)21/h1-5,7,9,11H,6,8,10H2,(H,22,26) |
| InChIKey | UAEQQTALKZIMEP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |