C9H9ClO2 — CID 91005922
6-(chloromethylidene)-2-methyl-3-methylidenecyclohexa-1,4-diene-1,4-diol (PubChem CID 91005922) has the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. Its IUPAC name is 6-(chloromethylidene)-2-methyl-3-methylidenecyclohexa-1,4-diene-1,4-diol.
| Compound Name | 6-(chloromethylidene)-2-methyl-3-methylidenecyclohexa-1,4-diene-1,4-diol |
|---|---|
| PubChem CID | 91005922 |
| Molecular Formula | C9H9ClO2 |
| Molecular Weight | 184.62 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | 6-(chloromethylidene)-2-methyl-3-methylidenecyclohexa-1,4-diene-1,4-diol |
| SMILES | C=c1c(O)cc(=CCl)c(O)c1C |
| InChI | InChI=1S/C9H9ClO2/c1-5-6(2)9(12)7(4-10)3-8(5)11/h3-4,11-12H,1H2,2H3 |
| InChIKey | YMMVRAHISYIWCA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.62 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|