C18H19ClN4O3S — CID 9100613
N-(3-chloro-4-cyanophenyl)-2-[5-(dimethylsulfamoyl)-2-methylanilino]acetamide (PubChem CID 9100613) has the molecular formula C18H19ClN4O3S and a molecular weight of 406.90 g/mol. Its IUPAC name is N-(3-chloro-4-cyanophenyl)-2-[5-(dimethylsulfamoyl)-2-methylanilino]acetamide.
| Compound Name | N-(3-chloro-4-cyanophenyl)-2-[5-(dimethylsulfamoyl)-2-methylanilino]acetamide |
|---|---|
| PubChem CID | 9100613 |
| Molecular Formula | C18H19ClN4O3S |
| Molecular Weight | 406.90 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | N-(3-chloro-4-cyanophenyl)-2-[5-(dimethylsulfamoyl)-2-methylanilino]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C)cc1NCC(=O)Nc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C18H19ClN4O3S/c1-12-4-7-15(27(25,26)23(2)3)9-17(12)21-11-18(24)22-14-6-5-13(10-20)16(19)8-14/h4-9,21H,11H2,1-3H3,(H,22,24) |
| InChIKey | MNCLFRKXABINAY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.90 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |