C27H40O3 — CID 91006241
5-[(1R,2R)-2-(2-butoxy-3,5-ditert-butylphenyl)cyclopropyl]-3-methylpenta-2,4-dienoic acid (PubChem CID 91006241) has the molecular formula C27H40O3 and a molecular weight of 412.61 g/mol. Its IUPAC name is 5-[(1R,2R)-2-(2-butoxy-3,5-ditert-butylphenyl)cyclopropyl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | 5-[(1R,2R)-2-(2-butoxy-3,5-ditert-butylphenyl)cyclopropyl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 91006241 |
| Molecular Formula | C27H40O3 |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | 5-[(1R,2R)-2-(2-butoxy-3,5-ditert-butylphenyl)cyclopropyl]-3-methylpenta-2,4-dienoic acid |
| SMILES | CCCCOc1c([C@@H]2C[C@@H]2C=CC(C)=CC(=O)O)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C27H40O3/c1-9-10-13-30-25-22(21-15-19(21)12-11-18(2)14-24(28)29)16-20(26(3,4)5)17-23(25)27(6,7)8/h11-12,14,16-17,19,21H,9-10,13,15H2,1-8H3,(H,28,29)/t19-,21+/m0/s1 |
| InChIKey | MVEZDCCYKRPTNZ-PZJWPPBQSA-N |
| XLogP | 7.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|