C21H16F12 — CID 91006512
1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-4-[3-[4-(trifluoromethyl)phenyl]butyl]benzene (PubChem CID 91006512) has the molecular formula C21H16F12 and a molecular weight of 496.34 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-4-[3-[4-(trifluoromethyl)phenyl]butyl]benzene.
| Compound Name | 1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-4-[3-[4-(trifluoromethyl)phenyl]butyl]benzene |
|---|---|
| PubChem CID | 91006512 |
| Molecular Formula | C21H16F12 |
| Molecular Weight | 496.34 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-4-[3-[4-(trifluoromethyl)phenyl]butyl]benzene |
| SMILES | CC(CCc1ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H16F12/c1-12(14-6-10-16(11-7-14)18(24,25)26)2-3-13-4-8-15(9-5-13)17(22,23)19(27,28)20(29,30)21(31,32)33/h4-12H,2-3H2,1H3 |
| InChIKey | CEOKOKNJQTWBND-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.34 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|