C20H23F13O4 — CID 91006606
2-(2-ethylhexyl)-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)but-2-enedioic acid (PubChem CID 91006606) has the molecular formula C20H23F13O4 and a molecular weight of 574.37 g/mol. Its IUPAC name is 2-(2-ethylhexyl)-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)but-2-enedioic acid.
| Compound Name | 2-(2-ethylhexyl)-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)but-2-enedioic acid |
|---|---|
| PubChem CID | 91006606 |
| Molecular Formula | C20H23F13O4 |
| Molecular Weight | 574.37 g/mol |
| Exact Mass | 574.14 |
| IUPAC Name | 2-(2-ethylhexyl)-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)but-2-enedioic acid |
| SMILES | CCCCC(CC)CC(C(=O)O)=C(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C20H23F13O4/c1-3-5-6-10(4-2)9-12(14(36)37)11(13(34)35)7-8-15(21,22)16(23,24)17(25,26)18(27,28)19(29,30)20(31,32)33/h10H,3-9H2,1-2H3,(H,34,35)(H,36,37) |
| InChIKey | QCXNONCODLPOBD-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.37 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|