C19H20N2 — CID 91006614
9-benzyl-5-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole (PubChem CID 91006614) has the molecular formula C19H20N2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 9-benzyl-5-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole.
| Compound Name | 9-benzyl-5-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 91006614 |
| Molecular Formula | C19H20N2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 9-benzyl-5-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole |
| SMILES | Cc1cccc2c1c1c(n2Cc2ccccc2)CNCC1 |
| InChI | InChI=1S/C19H20N2/c1-14-6-5-9-17-19(14)16-10-11-20-12-18(16)21(17)13-15-7-3-2-4-8-15/h2-9,20H,10-13H2,1H3 |
| InChIKey | FWOOSXBWPAENHZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |