C30H18O10 — CID 91006618
7a-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-1a-phenyloxireno[2,3-b]chromen-7-one (PubChem CID 91006618) has the molecular formula C30H18O10 and a molecular weight of 538.46 g/mol. Its IUPAC name is 7a-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-1a-phenyloxireno[2,3-b]chromen-7-one.
| Compound Name | 7a-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-1a-phenyloxireno[2,3-b]chromen-7-one |
|---|---|
| PubChem CID | 91006618 |
| Molecular Formula | C30H18O10 |
| Molecular Weight | 538.46 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | 7a-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-1a-phenyloxireno[2,3-b]chromen-7-one |
| SMILES | O=C1c2ccccc2OC2(c3ccccc3)OC12c1c(O)cc(O)c2c(=O)c(O)c(-c3ccc(O)c(O)c3)oc12 |
| InChI | InChI=1S/C30H18O10/c31-17-11-10-14(12-18(17)32)26-25(36)24(35)22-19(33)13-20(34)23(27(22)38-26)29-28(37)16-8-4-5-9-21(16)39-30(29,40-29)15-6-2-1-3-7-15/h1-13,31-34,36H |
| InChIKey | ZJONIBFAADXSLY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 170.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|